C13H15NO7S — CID 170982910
(4S)-4-methyl-3-phenylmethoxycarbonyloxathiazolidine-2,2-dicarboxylic acid (PubChem CID 170982910) has the molecular formula C13H15NO7S and a molecular weight of 329.33 g/mol. Its IUPAC name is (4S)-4-methyl-3-phenylmethoxycarbonyloxathiazolidine-2,2-dicarboxylic acid.
| Compound Name | (4S)-4-methyl-3-phenylmethoxycarbonyloxathiazolidine-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 170982910 |
| Molecular Formula | C13H15NO7S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | (4S)-4-methyl-3-phenylmethoxycarbonyloxathiazolidine-2,2-dicarboxylic acid |
| SMILES | C[C@H]1COS(C(=O)O)(C(=O)O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15NO7S/c1-9-7-21-22(12(16)17,13(18)19)14(9)11(15)20-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChIKey | KOJLPWPHRQPTLX-VIFPVBQESA-N |
| XLogP | 3.03 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|