C16H21N3O4 — CID 170985086
tert-butyl N-[6-(ethoxycarbonylamino)-1H-indol-4-yl]carbamate (PubChem CID 170985086) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl N-[6-(ethoxycarbonylamino)-1H-indol-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-(ethoxycarbonylamino)-1H-indol-4-yl]carbamate |
|---|---|
| PubChem CID | 170985086 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl N-[6-(ethoxycarbonylamino)-1H-indol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc(NC(=O)OC(C)(C)C)c2cc[nH]c2c1 |
| InChI | InChI=1S/C16H21N3O4/c1-5-22-14(20)18-10-8-12-11(6-7-17-12)13(9-10)19-15(21)23-16(2,3)4/h6-9,17H,5H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | PTSYSWXMOHXVBB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |