C13H18N4O2 — CID 142493312
tert-butyl N-[7-(aminomethyl)-3H-benzimidazol-5-yl]carbamate (PubChem CID 142493312) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl N-[7-(aminomethyl)-3H-benzimidazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[7-(aminomethyl)-3H-benzimidazol-5-yl]carbamate |
|---|---|
| PubChem CID | 142493312 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl N-[7-(aminomethyl)-3H-benzimidazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CN)c2nc[nH]c2c1 |
| InChI | InChI=1S/C13H18N4O2/c1-13(2,3)19-12(18)17-9-4-8(6-14)11-10(5-9)15-7-16-11/h4-5,7H,6,14H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | XUPOFVRQWLNEFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |