C11H14N4O2 — CID 70964464
tert-butyl N-(1H-imidazo[4,5-c]pyridin-4-yl)carbamate (PubChem CID 70964464) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is tert-butyl N-(1H-imidazo[4,5-c]pyridin-4-yl)carbamate.
| Compound Name | tert-butyl N-(1H-imidazo[4,5-c]pyridin-4-yl)carbamate |
|---|---|
| PubChem CID | 70964464 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | tert-butyl N-(1H-imidazo[4,5-c]pyridin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nccc2[nH]cnc12 |
| InChI | InChI=1S/C11H14N4O2/c1-11(2,3)17-10(16)15-9-8-7(4-5-12-9)13-6-14-8/h4-6H,1-3H3,(H,13,14)(H,12,15,16) |
| InChIKey | WUULPJCPVQBJNO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |