C14H27NO7S — CID 170985901
[5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxypentyl] acetate (PubChem CID 170985901) has the molecular formula C14H27NO7S and a molecular weight of 353.44 g/mol. Its IUPAC name is [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxypentyl] acetate.
| Compound Name | [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxypentyl] acetate |
|---|---|
| PubChem CID | 170985901 |
| Molecular Formula | C14H27NO7S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylsulfonyloxypentyl] acetate |
| SMILES | CC(=O)OCC(CCCN(C)C(=O)OC(C)(C)C)OS(C)(=O)=O |
| InChI | InChI=1S/C14H27NO7S/c1-11(16)20-10-12(22-23(6,18)19)8-7-9-15(5)13(17)21-14(2,3)4/h12H,7-10H2,1-6H3 |
| InChIKey | ILLMQSUOHZDYFJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|