C15H24O3 — CID 170988534
(1R,2S,3S,5R,6R,9R)-3-hydroxy-2,11,11-trimethyltricyclo[4.3.2.01,5]undecane-9-carboxylic acid (PubChem CID 170988534) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,9R)-3-hydroxy-2,11,11-trimethyltricyclo[4.3.2.01,5]undecane-9-carboxylic acid.
| Compound Name | (1R,2S,3S,5R,6R,9R)-3-hydroxy-2,11,11-trimethyltricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 170988534 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,2S,3S,5R,6R,9R)-3-hydroxy-2,11,11-trimethyltricyclo[4.3.2.01,5]undecane-9-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](O)C[C@@H]2[C@H]3CC[C@@H](C(=O)O)[C@@]12CC3(C)C |
| InChI | InChI=1S/C15H24O3/c1-8-12(16)6-11-9-4-5-10(13(17)18)15(8,11)7-14(9,2)3/h8-12,16H,4-7H2,1-3H3,(H,17,18)/t8-,9-,10+,11-,12+,15-/m1/s1 |
| InChIKey | KWCPDTZFODUXSJ-SCIJBCKKSA-N |
| XLogP | 2.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |