C16H28O5 — CID 170988576
(E)-5-hydroxy-2,4,6-trimethyl-2-(3-oxopentoxy)oct-3-enoic acid (PubChem CID 170988576) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is (E)-5-hydroxy-2,4,6-trimethyl-2-(3-oxopentoxy)oct-3-enoic acid.
| Compound Name | (E)-5-hydroxy-2,4,6-trimethyl-2-(3-oxopentoxy)oct-3-enoic acid |
|---|---|
| PubChem CID | 170988576 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (E)-5-hydroxy-2,4,6-trimethyl-2-(3-oxopentoxy)oct-3-enoic acid |
| SMILES | CCC(=O)CCOC(C)(/C=C(\C)C(O)C(C)CC)C(=O)O |
| InChI | InChI=1S/C16H28O5/c1-6-11(3)14(18)12(4)10-16(5,15(19)20)21-9-8-13(17)7-2/h10-11,14,18H,6-9H2,1-5H3,(H,19,20)/b12-10+ |
| InChIKey | NLSIKSDFPRQNMY-ZRDIBKRKSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|