C17H28O5 — CID 170988922
(5S,6R)-3-[(E)-5,8-dihydroxynon-3-enyl]-5,6-dihydroxy-2,6-dimethylcyclohex-2-en-1-one (PubChem CID 170988922) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is (5S,6R)-3-[(E)-5,8-dihydroxynon-3-enyl]-5,6-dihydroxy-2,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (5S,6R)-3-[(E)-5,8-dihydroxynon-3-enyl]-5,6-dihydroxy-2,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 170988922 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (5S,6R)-3-[(E)-5,8-dihydroxynon-3-enyl]-5,6-dihydroxy-2,6-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=C(CC/C=C/C(O)CCC(C)O)C[C@H](O)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C17H28O5/c1-11(18)8-9-14(19)7-5-4-6-13-10-15(20)17(3,22)16(21)12(13)2/h5,7,11,14-15,18-20,22H,4,6,8-10H2,1-3H3/b7-5+/t11?,14?,15-,17+/m0/s1 |
| InChIKey | XFNXZQGCLVNNRO-TVMYWDMMSA-N |
| XLogP | 1.25 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|