C19H26BN3O4 — CID 170993142
3-butyl-1-(4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 170993142) has the molecular formula C19H26BN3O4 and a molecular weight of 371.25 g/mol. Its IUPAC name is 3-butyl-1-(4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-butyl-1-(4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 170993142 |
| Molecular Formula | C19H26BN3O4 |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-butyl-1-(4-nitrophenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CCCCc1nn(-c2ccc([N+](=O)[O-])cc2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H26BN3O4/c1-6-7-8-17-16(20-26-18(2,3)19(4,5)27-20)13-22(21-17)14-9-11-15(12-10-14)23(24)25/h9-13H,6-8H2,1-5H3 |
| InChIKey | HAYIEJUMGNWVMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|