C8H6F5NO3S — CID 170998897
3-(difluoromethyl)-5-(trifluoromethoxy)benzenesulfonamide (PubChem CID 170998897) has the molecular formula C8H6F5NO3S and a molecular weight of 291.20 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 3-(difluoromethyl)-5-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 170998897 |
| Molecular Formula | C8H6F5NO3S |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 3-(difluoromethyl)-5-(trifluoromethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(OC(F)(F)F)cc(C(F)F)c1 |
| InChI | InChI=1S/C8H6F5NO3S/c9-7(10)4-1-5(17-8(11,12)13)3-6(2-4)18(14,15)16/h1-3,7H,(H2,14,15,16) |
| InChIKey | YZGITEJXRGYQKF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |