About zinc;trifluoromethylbenzene;bromide
zinc;trifluoromethylbenzene;bromide (PubChem CID 171000038) has the molecular formula C7H4BrF3Zn
and a molecular weight of 290.40 g/mol. Its IUPAC name is zinc;trifluoromethylbenzene;bromide.
Molecular Properties
| Compound Name | zinc;trifluoromethylbenzene;bromide |
| PubChem CID | 171000038 |
| Molecular Formula | C7H4BrF3Zn |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 287.87 |
| IUPAC Name | zinc;trifluoromethylbenzene;bromide |
| SMILES | FC(F)(F)c1cc[c-]cc1.[Br-].[Zn+2] |
| InChI | InChI=1S/C7H4F3.BrH.Zn/c8-7(9,10)6-4-2-1-3-5-6;;/h2-5H;1H;/q-1;;+2/p-1 |
| InChIKey | QTZYUXHHCTXHDM-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;trifluoromethylbenzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;trifluoromethylbenzene;bromide?
The IUPAC name of zinc;trifluoromethylbenzene;bromide (CID 171000038) is zinc;trifluoromethylbenzene;bromide.
What is the SMILES notation for zinc;trifluoromethylbenzene;bromide?
The canonical SMILES for zinc;trifluoromethylbenzene;bromide is FC(F)(F)c1cc[c-]cc1.[Br-].[Zn+2].
What is the InChIKey of zinc;trifluoromethylbenzene;bromide?
The InChIKey is QTZYUXHHCTXHDM-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4F3.BrH.Zn/c8-7(9,10)6-4-2-1-3-5-6;;/h2-5H;1H;/q-1;;+2/p-1.
What are the key properties of zinc;trifluoromethylbenzene;bromide?
zinc;trifluoromethylbenzene;bromide has a molecular weight of 290.40 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;trifluoromethylbenzene;bromide is sourced from PubChem (CID 171000038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).