About carbanide;einsteinium;trifluoromethylbenzene
carbanide;einsteinium;trifluoromethylbenzene (PubChem CID 162562480) has the molecular formula C8H7EsF3-2
and a molecular weight of 412.14 g/mol. Its IUPAC name is carbanide;einsteinium;trifluoromethylbenzene.
Molecular Properties
| Compound Name | carbanide;einsteinium;trifluoromethylbenzene |
| PubChem CID | 162562480 |
| Molecular Formula | C8H7EsF3-2 |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | carbanide;einsteinium;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1cc[c-]cc1.[CH3-].[Es] |
| InChI | InChI=1S/C7H4F3.CH3.Es/c8-7(9,10)6-4-2-1-3-5-6;;/h2-5H;1H3;/q2*-1; |
| InChIKey | OAWXVAMMKDRHAN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;einsteinium;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;einsteinium;trifluoromethylbenzene?
The IUPAC name of carbanide;einsteinium;trifluoromethylbenzene (CID 162562480) is carbanide;einsteinium;trifluoromethylbenzene.
What is the SMILES notation for carbanide;einsteinium;trifluoromethylbenzene?
The canonical SMILES for carbanide;einsteinium;trifluoromethylbenzene is FC(F)(F)c1cc[c-]cc1.[CH3-].[Es].
What is the InChIKey of carbanide;einsteinium;trifluoromethylbenzene?
The InChIKey is OAWXVAMMKDRHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3.CH3.Es/c8-7(9,10)6-4-2-1-3-5-6;;/h2-5H;1H3;/q2*-1;.
What are the key properties of carbanide;einsteinium;trifluoromethylbenzene?
carbanide;einsteinium;trifluoromethylbenzene has a molecular weight of 412.14 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;einsteinium;trifluoromethylbenzene is sourced from PubChem (CID 162562480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).