C9H8ClIO — CID 171002077
2-iodo-3,6-dimethylbenzoyl chloride (PubChem CID 171002077) has the molecular formula C9H8ClIO and a molecular weight of 294.52 g/mol. Its IUPAC name is 2-iodo-3,6-dimethylbenzoyl chloride.
| Compound Name | 2-iodo-3,6-dimethylbenzoyl chloride |
|---|---|
| PubChem CID | 171002077 |
| Molecular Formula | C9H8ClIO |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | 2-iodo-3,6-dimethylbenzoyl chloride |
| SMILES | Cc1ccc(C)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C9H8ClIO/c1-5-3-4-6(2)8(11)7(5)9(10)12/h3-4H,1-2H3 |
| InChIKey | HEVYWKDSRHLHRX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|