C7H4Br2Cl2 — CID 171009765
1,3-dibromo-2-chloro-4-(chloromethyl)benzene (PubChem CID 171009765) has the molecular formula C7H4Br2Cl2 and a molecular weight of 318.82 g/mol. Its IUPAC name is 1,3-dibromo-2-chloro-4-(chloromethyl)benzene.
| Compound Name | 1,3-dibromo-2-chloro-4-(chloromethyl)benzene |
|---|---|
| PubChem CID | 171009765 |
| Molecular Formula | C7H4Br2Cl2 |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 315.81 |
| IUPAC Name | 1,3-dibromo-2-chloro-4-(chloromethyl)benzene |
| SMILES | ClCc1ccc(Br)c(Cl)c1Br |
| InChI | InChI=1S/C7H4Br2Cl2/c8-5-2-1-4(3-10)6(9)7(5)11/h1-2H,3H2 |
| InChIKey | FRYYDQUVLZHIOH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|