C10H11F2NO2 — CID 171029463
methyl 2-[4-(difluoromethyl)-6-methyl-3-pyridinyl]acetate (PubChem CID 171029463) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl 2-[4-(difluoromethyl)-6-methyl-3-pyridinyl]acetate.
| Compound Name | methyl 2-[4-(difluoromethyl)-6-methyl-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 171029463 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | methyl 2-[4-(difluoromethyl)-6-methyl-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(C)cc1C(F)F |
| InChI | InChI=1S/C10H11F2NO2/c1-6-3-8(10(11)12)7(5-13-6)4-9(14)15-2/h3,5,10H,4H2,1-2H3 |
| InChIKey | QKBOTWAHAZCVHW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |