C14H18F3NO2 — CID 171044379
[2-methyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl] (2S)-2-aminopropanoate (PubChem CID 171044379) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is [2-methyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl] (2S)-2-aminopropanoate.
| Compound Name | [2-methyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 171044379 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [2-methyl-1-[4-(trifluoromethyl)phenyl]propan-2-yl] (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OC(C)(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO2/c1-9(18)12(19)20-13(2,3)8-10-4-6-11(7-5-10)14(15,16)17/h4-7,9H,8,18H2,1-3H3/t9-/m0/s1 |
| InChIKey | XURZDQKWBFJVTE-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |