C11H17NO — CID 171046396
5,6-di(propan-2-yl)-3H-pyridin-2-one (PubChem CID 171046396) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 5,6-di(propan-2-yl)-3H-pyridin-2-one.
| Compound Name | 5,6-di(propan-2-yl)-3H-pyridin-2-one |
|---|---|
| PubChem CID | 171046396 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 5,6-di(propan-2-yl)-3H-pyridin-2-one |
| SMILES | CC(C)C1=CCC(=O)N=C1C(C)C |
| InChI | InChI=1S/C11H17NO/c1-7(2)9-5-6-10(13)12-11(9)8(3)4/h5,7-8H,6H2,1-4H3 |
| InChIKey | NLCCGCMBVVNEPC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |