C84H70N4OPtSi-2 — CID 171046653
CID 171046653 (PubChem CID 171046653) has the molecular formula C84H70N4OPtSi-2 and a molecular weight of 1389.77 g/mol.
| Compound Name | CID 171046653 |
|---|---|
| PubChem CID | 171046653 |
| Molecular Formula | C84H70N4OPtSi-2 |
| Molecular Weight | 1389.77 g/mol |
| Exact Mass | 1388.59 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c([Si](c2cc3c4c(c2)n(-c2[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)ccc2)[c-][n+]4-c2c(-c4ccc(C(C)(C)C)cc4)cc(C(C)(C)C)cc2-c2ccccc2-c2ccccc2-3)(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C84H70N4OSi.Pt/c1-82(2,3)57-42-40-56(41-43-57)73-48-59(84(7,8)9)49-74-69-36-21-19-34-67(69)68-35-20-22-37-70(68)75-53-66(90(63-28-13-10-14-29-63,64-30-15-11-16-31-64)65-32-17-12-18-33-65)54-78-81(75)87(80(73)74)55-86(78)60-26-25-27-61(51-60)89-62-44-45-72-71-38-23-24-39-76(71)88(77(72)52-62)79-50-58(46-47-85-79)83(4,5)6;/h10-50,53-54H,1-9H3;/q-2;/i10D,11D,12D,13D,14D,15D,16D,17D,18D,28D,29D,30D,31D,32D,33D; |
| InChIKey | ZMTYVIIRWYQPCF-FMLCLDBSSA-N |
| XLogP | 17.84 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1389.77 |
| LogP ≤ 5 | 17.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|