C78H63N5OPt-2 — CID 171047097
CID 171047097 (PubChem CID 171047097) has the molecular formula C78H63N5OPt-2 and a molecular weight of 1289.52 g/mol.
| Compound Name | CID 171047097 |
|---|---|
| PubChem CID | 171047097 |
| Molecular Formula | C78H63N5OPt-2 |
| Molecular Weight | 1289.52 g/mol |
| Exact Mass | 1288.52 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1cc(C(C)(C)C)cc(-n3c4ccccc4c4ccccc43)c1-[n+]1[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c3cc(-c4ccc(C(C)(C)C)cc4)cc(c31)-c1c([2H])c([2H])c([2H])c([2H])c1-2.[Pt] |
| InChI | InChI=1S/C78H63N5O.Pt/c1-76(2,3)51-35-33-49(34-36-51)50-41-65-59-25-12-10-23-57(59)58-24-11-13-26-60(58)66-43-53(78(7,8)9)44-72(82-67-30-17-14-27-61(67)62-28-15-18-31-68(62)82)75(66)81-48-80(71(42-50)74(65)81)54-21-20-22-55(46-54)84-56-37-38-64-63-29-16-19-32-69(63)83(70(64)47-56)73-45-52(39-40-79-73)77(4,5)6;/h10-45H,1-9H3;/q-2;/i10D,11D,12D,13D,23D,24D,25D,26D; |
| InChIKey | WHSYNVGCILHAKQ-LNNCWZJBSA-N |
| XLogP | 19.56 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1289.52 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|