C80H76N4OPt-2 — CID 171047143
CID 171047143 (PubChem CID 171047143) has the molecular formula C80H76N4OPt-2 and a molecular weight of 1312.64 g/mol.
| Compound Name | CID 171047143 |
|---|---|
| PubChem CID | 171047143 |
| Molecular Formula | C80H76N4OPt-2 |
| Molecular Weight | 1312.64 g/mol |
| Exact Mass | 1311.62 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1cc(C(C)(C)C)cc(-c3ccc(C(C)(C)C)cc3)c1-[n+]1[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(c31)-c1c([2H])c([2H])c([2H])c([2H])c1-2.[Pt] |
| InChI | InChI=1S/C80H76N4O.Pt/c1-76(2,3)53-33-31-50(32-34-53)67-44-57(80(13,14)15)45-69-64-28-19-17-26-62(64)61-25-16-18-27-63(61)68-41-52(51-39-55(78(7,8)9)43-56(40-51)79(10,11)12)42-72-75(68)83(74(67)69)49-82(72)58-23-22-24-59(47-58)85-60-35-36-66-65-29-20-21-30-70(65)84(71(66)48-60)73-46-54(37-38-81-73)77(4,5)6;/h16-46H,1-15H3;/q-2;/i16D,17D,18D,19D,25D,26D,27D,28D; |
| InChIKey | GOBNNORGKJWTBU-WDTVRQRZSA-N |
| XLogP | 20.73 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1312.64 |
| LogP ≤ 5 | 20.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|