C27H19F4N3O2 — CID 171060897
2-[2,6-bis[difluoro(phenyl)methyl]-4-nitrophenyl]-1-pyridin-2-ylethanimine (PubChem CID 171060897) has the molecular formula C27H19F4N3O2 and a molecular weight of 493.46 g/mol. Its IUPAC name is 2-[2,6-bis[difluoro(phenyl)methyl]-4-nitrophenyl]-1-pyridin-2-ylethanimine.
| Compound Name | 2-[2,6-bis[difluoro(phenyl)methyl]-4-nitrophenyl]-1-pyridin-2-ylethanimine |
|---|---|
| PubChem CID | 171060897 |
| Molecular Formula | C27H19F4N3O2 |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 2-[2,6-bis[difluoro(phenyl)methyl]-4-nitrophenyl]-1-pyridin-2-ylethanimine |
| SMILES | [H]/N=C(/Cc1c(C(F)(F)c2ccccc2)cc([N+](=O)[O-])cc1C(F)(F)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H19F4N3O2/c28-26(29,18-9-3-1-4-10-18)22-15-20(34(35)36)16-23(27(30,31)19-11-5-2-6-12-19)21(22)17-24(32)25-13-7-8-14-33-25/h1-16,32H,17H2/b32-24- |
| InChIKey | JKVKXGVAYXGRCQ-TZHWMEPESA-N |
| XLogP | 6.88 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|