C20H37BrN2O — CID 171065115
3-amino-4-(5-bromo-1H-indol-3-yl)butan-2-one;ethane (PubChem CID 171065115) has the molecular formula C20H37BrN2O and a molecular weight of 401.43 g/mol. Its IUPAC name is 3-amino-4-(5-bromo-1H-indol-3-yl)butan-2-one;ethane.
| Compound Name | 3-amino-4-(5-bromo-1H-indol-3-yl)butan-2-one;ethane |
|---|---|
| PubChem CID | 171065115 |
| Molecular Formula | C20H37BrN2O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-amino-4-(5-bromo-1H-indol-3-yl)butan-2-one;ethane |
| SMILES | CC.CC.CC.CC.CC(=O)C(N)Cc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C12H13BrN2O.4C2H6/c1-7(16)11(14)4-8-6-15-12-3-2-9(13)5-10(8)12;4*1-2/h2-3,5-6,11,15H,4,14H2,1H3;4*1-2H3 |
| InChIKey | CGDJBBVZGCMOHS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |