C15H16N6O3 — CID 171066938
6-(3-methyl-1,2,4-triazol-4-yl)-4-nitro-1-(oxan-2-yl)indazole (PubChem CID 171066938) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 6-(3-methyl-1,2,4-triazol-4-yl)-4-nitro-1-(oxan-2-yl)indazole.
| Compound Name | 6-(3-methyl-1,2,4-triazol-4-yl)-4-nitro-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 171066938 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 6-(3-methyl-1,2,4-triazol-4-yl)-4-nitro-1-(oxan-2-yl)indazole |
| SMILES | Cc1nncn1-c1cc([N+](=O)[O-])c2cnn(C3CCCCO3)c2c1 |
| InChI | InChI=1S/C15H16N6O3/c1-10-18-16-9-19(10)11-6-13-12(14(7-11)21(22)23)8-17-20(13)15-4-2-3-5-24-15/h6-9,15H,2-5H2,1H3 |
| InChIKey | AKUKHFHYEFRJDD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|