C37H40N8O5 — CID 171069969
3-[6-[4-[2-[4-[4-(6-hydroxy-4-oxoquinazolin-3-yl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171069969) has the molecular formula C37H40N8O5 and a molecular weight of 676.78 g/mol. Its IUPAC name is 3-[6-[4-[2-[4-[4-(6-hydroxy-4-oxoquinazolin-3-yl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[2-[4-[4-(6-hydroxy-4-oxoquinazolin-3-yl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171069969 |
| Molecular Formula | C37H40N8O5 |
| Molecular Weight | 676.78 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | 3-[6-[4-[2-[4-[4-(6-hydroxy-4-oxoquinazolin-3-yl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(CCN5CCN(c6ccc(-n7cnc8ccc(O)cc8c7=O)cc6)CC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C37H40N8O5/c46-29-6-8-32-31(22-29)37(50)45(24-38-32)27-3-1-26(2-4-27)42-17-13-40(14-18-42)11-12-41-15-19-43(20-16-41)28-5-7-30-25(21-28)23-44(36(30)49)33-9-10-34(47)39-35(33)48/h1-8,21-22,24,33,46H,9-20,23H2,(H,39,47,48) |
| InChIKey | MPFAGQNAMYZTPP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.78 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|