C43H86N4O — CID 171073885
4-(dioctylamino)-2-[(1-methylpiperidin-4-yl)amino]-N,N-dioctylpent-4-enamide (PubChem CID 171073885) has the molecular formula C43H86N4O and a molecular weight of 675.19 g/mol. Its IUPAC name is 4-(dioctylamino)-2-[(1-methylpiperidin-4-yl)amino]-N,N-dioctylpent-4-enamide.
| Compound Name | 4-(dioctylamino)-2-[(1-methylpiperidin-4-yl)amino]-N,N-dioctylpent-4-enamide |
|---|---|
| PubChem CID | 171073885 |
| Molecular Formula | C43H86N4O |
| Molecular Weight | 675.19 g/mol |
| Exact Mass | 674.68 |
| IUPAC Name | 4-(dioctylamino)-2-[(1-methylpiperidin-4-yl)amino]-N,N-dioctylpent-4-enamide |
| SMILES | C=C(CC(NC1CCN(C)CC1)C(=O)N(CCCCCCCC)CCCCCCCC)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C43H86N4O/c1-7-11-15-19-23-27-33-46(34-28-24-20-16-12-8-2)40(5)39-42(44-41-31-37-45(6)38-32-41)43(48)47(35-29-25-21-17-13-9-3)36-30-26-22-18-14-10-4/h41-42,44H,5,7-39H2,1-4,6H3 |
| InChIKey | UNEUQDKPUMWGKX-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.19 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|