C16H24ClNO4 — CID 171074585
5-chloro-2-methoxy-3-(2-morpholin-4-ylethyl)benzoic acid;ethane (PubChem CID 171074585) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is 5-chloro-2-methoxy-3-(2-morpholin-4-ylethyl)benzoic acid;ethane.
| Compound Name | 5-chloro-2-methoxy-3-(2-morpholin-4-ylethyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 171074585 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-chloro-2-methoxy-3-(2-morpholin-4-ylethyl)benzoic acid;ethane |
| SMILES | CC.COc1c(CCN2CCOCC2)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C14H18ClNO4.C2H6/c1-19-13-10(2-3-16-4-6-20-7-5-16)8-11(15)9-12(13)14(17)18;1-2/h8-9H,2-7H2,1H3,(H,17,18);1-2H3 |
| InChIKey | LVPGIQRSMNOGIA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |