C36H44F4N4O3S — CID 171077195
3-[3-(6,18-diamino-4,14,14,22-tetrafluoro-7,17-dimethyl-20-methylimino-2-oxa-11-thia-19-azatricyclo[19.3.1.03,8]pentacosa-1(25),3,5,7,18,21,23-heptaen-17-yl)phenyl]propanoic acid;ethane (PubChem CID 171077195) has the molecular formula C36H44F4N4O3S and a molecular weight of 688.83 g/mol. Its IUPAC name is 3-[3-(6,18-diamino-4,14,14,22-tetrafluoro-7,17-dimethyl-20-methylimino-2-oxa-11-thia-19-azatricyclo[19.3.1.03,8]pentacosa-1(25),3,5,7,18,21,23-heptaen-17-yl)phenyl]propanoic acid;ethane.
| Compound Name | 3-[3-(6,18-diamino-4,14,14,22-tetrafluoro-7,17-dimethyl-20-methylimino-2-oxa-11-thia-19-azatricyclo[19.3.1.03,8]pentacosa-1(25),3,5,7,18,21,23-heptaen-17-yl)phenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 171077195 |
| Molecular Formula | C36H44F4N4O3S |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 3-[3-(6,18-diamino-4,14,14,22-tetrafluoro-7,17-dimethyl-20-methylimino-2-oxa-11-thia-19-azatricyclo[19.3.1.03,8]pentacosa-1(25),3,5,7,18,21,23-heptaen-17-yl)phenyl]propanoic acid;ethane |
| SMILES | C/N=C1\N=C(/N)C(C)(c2cccc(CCC(=O)O)c2)CCC(F)(F)CCSCCc2c(C)c(N)cc(F)c2Oc2ccc(F)c1c2.CC |
| InChI | InChI=1S/C34H38F4N4O3S.C2H6/c1-20-24-11-15-46-16-14-34(37,38)13-12-33(2,22-6-4-5-21(17-22)7-10-29(43)44)32(40)42-31(41-3)25-18-23(8-9-26(25)35)45-30(24)27(36)19-28(20)39;1-2/h4-6,8-9,17-19H,7,10-16,39H2,1-3H3,(H,43,44)(H2,40,41,42);1-2H3 |
| InChIKey | AFYSHJKGTBQDBD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|