C34H36F2N4O4S — CID 171076512
2-[3-(20-amino-4,24-difluoro-16,16,19-trimethyl-22-methylimino-2,18-dioxa-14-thia-7,21-diazatetracyclo[21.3.1.03,11.06,10]heptacosa-1(27),3,5,8,10,20,23,25-octaen-19-yl)phenyl]acetic acid (PubChem CID 171076512) has the molecular formula C34H36F2N4O4S and a molecular weight of 634.75 g/mol. Its IUPAC name is 2-[3-(20-amino-4,24-difluoro-16,16,19-trimethyl-22-methylimino-2,18-dioxa-14-thia-7,21-diazatetracyclo[21.3.1.03,11.06,10]heptacosa-1(27),3,5,8,10,20,23,25-octaen-19-yl)phenyl]acetic acid.
| Compound Name | 2-[3-(20-amino-4,24-difluoro-16,16,19-trimethyl-22-methylimino-2,18-dioxa-14-thia-7,21-diazatetracyclo[21.3.1.03,11.06,10]heptacosa-1(27),3,5,8,10,20,23,25-octaen-19-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171076512 |
| Molecular Formula | C34H36F2N4O4S |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 2-[3-(20-amino-4,24-difluoro-16,16,19-trimethyl-22-methylimino-2,18-dioxa-14-thia-7,21-diazatetracyclo[21.3.1.03,11.06,10]heptacosa-1(27),3,5,8,10,20,23,25-octaen-19-yl)phenyl]acetic acid |
| SMILES | C/N=C1/N=C(\N)C(C)(c2cccc(CC(=O)O)c2)OCC(C)(C)CSCCc2c(c(F)cc3[nH]ccc23)Oc2ccc(F)c1c2 |
| InChI | InChI=1S/C34H36F2N4O4S/c1-33(2)18-43-34(3,21-7-5-6-20(14-21)15-29(41)42)32(37)40-31(38-4)25-16-22(8-9-26(25)35)44-30-24(11-13-45-19-33)23-10-12-39-28(23)17-27(30)36/h5-10,12,14,16-17,39H,11,13,15,18-19H2,1-4H3,(H,41,42)(H2,37,38,40) |
| InChIKey | GVPPWACPHDHRHB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|