C35H38F2N4O2S — CID 174269446
3-(21-amino-4,25-difluoro-16,16,20-trimethyl-23-methylimino-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl)benzaldehyde (PubChem CID 174269446) has the molecular formula C35H38F2N4O2S and a molecular weight of 616.78 g/mol. Its IUPAC name is 3-(21-amino-4,25-difluoro-16,16,20-trimethyl-23-methylimino-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl)benzaldehyde.
| Compound Name | 3-(21-amino-4,25-difluoro-16,16,20-trimethyl-23-methylimino-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl)benzaldehyde |
|---|---|
| PubChem CID | 174269446 |
| Molecular Formula | C35H38F2N4O2S |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | 3-(21-amino-4,25-difluoro-16,16,20-trimethyl-23-methylimino-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl)benzaldehyde |
| SMILES | C/N=C1\N=C(/N)C(C)(c2cccc(C=O)c2)CCCC(C)(C)CSCCc2c(c(F)cc3[nH]ccc23)Oc2ccc(F)c1c2 |
| InChI | InChI=1S/C35H38F2N4O2S/c1-34(2)13-6-14-35(3,23-8-5-7-22(17-23)20-42)33(38)41-32(39-4)27-18-24(9-10-28(27)36)43-31-26(12-16-44-21-34)25-11-15-40-30(25)19-29(31)37/h5,7-11,15,17-20,40H,6,12-14,16,21H2,1-4H3,(H2,38,39,41) |
| InChIKey | AMIICAFTRVPGQM-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|