C35H40FN5O2S2 — CID 174270735
2-[3-[(20R)-21-amino-4-fluoro-16,16,20-trimethyl-23-methylimino-2,14-dithia-7,22,25-triazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl]phenyl]acetic acid (PubChem CID 174270735) has the molecular formula C35H40FN5O2S2 and a molecular weight of 645.87 g/mol. Its IUPAC name is 2-[3-[(20R)-21-amino-4-fluoro-16,16,20-trimethyl-23-methylimino-2,14-dithia-7,22,25-triazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[(20R)-21-amino-4-fluoro-16,16,20-trimethyl-23-methylimino-2,14-dithia-7,22,25-triazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 174270735 |
| Molecular Formula | C35H40FN5O2S2 |
| Molecular Weight | 645.87 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 2-[3-[(20R)-21-amino-4-fluoro-16,16,20-trimethyl-23-methylimino-2,14-dithia-7,22,25-triazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-20-yl]phenyl]acetic acid |
| SMILES | C/N=C1\N=C(/N)[C@@](C)(c2cccc(CC(=O)O)c2)CCCC(C)(C)CSCCc2c(c(F)cc3[nH]ccc23)Sc2ccnc1c2 |
| InChI | InChI=1S/C35H40FN5O2S2/c1-34(2)12-6-13-35(3,23-8-5-7-22(17-23)18-30(42)43)33(37)41-32(38-4)29-19-24(9-14-40-29)45-31-26(11-16-44-21-34)25-10-15-39-28(25)20-27(31)36/h5,7-10,14-15,17,19-20,39H,6,11-13,16,18,21H2,1-4H3,(H,42,43)(H2,37,38,41)/t35-/m1/s1 |
| InChIKey | PZJZTOHHLKZLQT-PGUFJCEWSA-N |
| XLogP | 7.66 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.87 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|