C38H46F2N4OS — CID 174269121
4,25-difluoro-16,16,20-trimethyl-23-methylimino-20-[3-(2-methylpropyl)phenyl]-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-21-amine (PubChem CID 174269121) has the molecular formula C38H46F2N4OS and a molecular weight of 644.88 g/mol. Its IUPAC name is 4,25-difluoro-16,16,20-trimethyl-23-methylimino-20-[3-(2-methylpropyl)phenyl]-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-21-amine.
| Compound Name | 4,25-difluoro-16,16,20-trimethyl-23-methylimino-20-[3-(2-methylpropyl)phenyl]-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-21-amine |
|---|---|
| PubChem CID | 174269121 |
| Molecular Formula | C38H46F2N4OS |
| Molecular Weight | 644.88 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 4,25-difluoro-16,16,20-trimethyl-23-methylimino-20-[3-(2-methylpropyl)phenyl]-2-oxa-14-thia-7,22-diazatetracyclo[22.3.1.03,11.06,10]octacosa-1(28),3,5,8,10,21,24,26-octaen-21-amine |
| SMILES | C/N=C1\N=C(/N)C(C)(c2cccc(CC(C)C)c2)CCCC(C)(C)CSCCc2c(c(F)cc3[nH]ccc23)Oc2ccc(F)c1c2 |
| InChI | InChI=1S/C38H46F2N4OS/c1-24(2)19-25-9-7-10-26(20-25)38(5)16-8-15-37(3,4)23-46-18-14-29-28-13-17-43-33(28)22-32(40)34(29)45-27-11-12-31(39)30(21-27)35(42-6)44-36(38)41/h7,9-13,17,20-22,24,43H,8,14-16,18-19,23H2,1-6H3,(H2,41,42,44) |
| InChIKey | XOJRPIHQDZZHNS-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.88 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|