C14H21BrO2 — CID 171079478
3-[3-(3-bromophenyl)propoxy]-2,2-dimethylpropan-1-ol (PubChem CID 171079478) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 3-[3-(3-bromophenyl)propoxy]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[3-(3-bromophenyl)propoxy]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 171079478 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-[3-(3-bromophenyl)propoxy]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)COCCCc1cccc(Br)c1 |
| InChI | InChI=1S/C14H21BrO2/c1-14(2,10-16)11-17-8-4-6-12-5-3-7-13(15)9-12/h3,5,7,9,16H,4,6,8,10-11H2,1-2H3 |
| InChIKey | WBZYVFCKAQLDHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|