C16H22N2O5 — CID 171079943
[3-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxymethanetriol (PubChem CID 171079943) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [3-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxymethanetriol.
| Compound Name | [3-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxymethanetriol |
|---|---|
| PubChem CID | 171079943 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [3-[2-[2-(hydroxymethyl)pyrrolidin-1-yl]ethyl]-1H-indol-5-yl]oxymethanetriol |
| SMILES | OCC1CCCN1CCc1c[nH]c2ccc(OC(O)(O)O)cc12 |
| InChI | InChI=1S/C16H22N2O5/c19-10-12-2-1-6-18(12)7-5-11-9-17-15-4-3-13(8-14(11)15)23-16(20,21)22/h3-4,8-9,12,17,19-22H,1-2,5-7,10H2 |
| InChIKey | AZMMNXJXONLRLQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|