C20H31N3O2 — CID 177026451
formaldehyde;4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine (PubChem CID 177026451) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is formaldehyde;4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine.
| Compound Name | formaldehyde;4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 177026451 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | formaldehyde;4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine |
| SMILES | C=O.CNCCCCN1CCCC1Cc1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H29N3O.CH2O/c1-20-9-3-4-10-22-11-5-6-16(22)12-15-14-21-19-8-7-17(23-2)13-18(15)19;1-2/h7-8,13-14,16,20-21H,3-6,9-12H2,1-2H3;1H2 |
| InChIKey | LJNAFAAXINWGGK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|