C24H30N2O — CID 176854720
5-methoxy-3-[[(2R)-1-[(4-propan-2-ylphenyl)methyl]pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 176854720) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 5-methoxy-3-[[(2R)-1-[(4-propan-2-ylphenyl)methyl]pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-methoxy-3-[[(2R)-1-[(4-propan-2-ylphenyl)methyl]pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 176854720 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 5-methoxy-3-[[(2R)-1-[(4-propan-2-ylphenyl)methyl]pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | COc1ccc2[nH]cc(C[C@H]3CCCN3Cc3ccc(C(C)C)cc3)c2c1 |
| InChI | InChI=1S/C24H30N2O/c1-17(2)19-8-6-18(7-9-19)16-26-12-4-5-21(26)13-20-15-25-24-11-10-22(27-3)14-23(20)24/h6-11,14-15,17,21,25H,4-5,12-13,16H2,1-3H3/t21-/m1/s1 |
| InChIKey | BZYQLEHAGCWGNE-OAQYLSRUSA-N |
| XLogP | 5.51 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |