C17H22B2N2O2 — CID 177026586
CID 177026586 (PubChem CID 177026586) has the molecular formula C17H22B2N2O2 and a molecular weight of 308.00 g/mol.
| Compound Name | CID 177026586 |
|---|---|
| PubChem CID | 177026586 |
| Molecular Formula | C17H22B2N2O2 |
| Molecular Weight | 308.00 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(CN1CCCC1Cc1c[nH]c2ccc(OC)cc12)OC |
| InChI | InChI=1S/C17H22B2N2O2/c1-22-14-5-6-16-15(9-14)12(10-20-16)8-13-4-3-7-21(13)11-17(18,19)23-2/h5-6,9-10,13,20H,3-4,7-8,11H2,1-2H3 |
| InChIKey | OPWCASHSTPSLSO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.00 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|