C21H30F3N3O2 — CID 177026595
4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine;2,2,2-trifluoroacetaldehyde (PubChem CID 177026595) has the molecular formula C21H30F3N3O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine;2,2,2-trifluoroacetaldehyde.
| Compound Name | 4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 177026595 |
| Molecular Formula | C21H30F3N3O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-[2-[(5-methoxy-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-N-methylbutan-1-amine;2,2,2-trifluoroacetaldehyde |
| SMILES | CNCCCCN1CCCC1Cc1c[nH]c2ccc(OC)cc12.O=CC(F)(F)F |
| InChI | InChI=1S/C19H29N3O.C2HF3O/c1-20-9-3-4-10-22-11-5-6-16(22)12-15-14-21-19-8-7-17(23-2)13-18(15)19;3-2(4,5)1-6/h7-8,13-14,16,20-21H,3-6,9-12H2,1-2H3;1H |
| InChIKey | YIORTWBHNDTNRL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|