C33H38BFN10O4S — CID 171081342
CID 171081342 (PubChem CID 171081342) has the molecular formula C33H38BFN10O4S and a molecular weight of 700.61 g/mol.
| Compound Name | CID 171081342 |
|---|---|
| PubChem CID | 171081342 |
| Molecular Formula | C33H38BFN10O4S |
| Molecular Weight | 700.61 g/mol |
| Exact Mass | 700.29 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2ccc(S(=O)(=O)NCCN(C)c3ncc(C(=O)NC4C(C)(C)CC4(C)C)cn3)cc2)nc1Nc1cccc(F)c1C(N)=O |
| InChI | InChI=1S/C33H38BFN10O4S/c1-32(2)18-33(3,4)29(32)44-28(47)19-15-38-31(39-16-19)45(5)14-13-40-50(48,49)21-11-9-20(10-12-21)41-30-37-17-22(34)27(43-30)42-24-8-6-7-23(35)25(24)26(36)46/h6-12,15-17,29,40H,13-14,18H2,1-5H3,(H2,36,46)(H,44,47)(H2,37,41,42,43) |
| InChIKey | OOXBHWRADHVBON-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 197.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|