C32H35IN6O6S — CID 171083270
tert-butyl 4-[1-[3-[2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-4-nitrophenoxy]phenyl]azetidin-3-yl]piperazine-1-carboxylate (PubChem CID 171083270) has the molecular formula C32H35IN6O6S and a molecular weight of 758.64 g/mol. Its IUPAC name is tert-butyl 4-[1-[3-[2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-4-nitrophenoxy]phenyl]azetidin-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[3-[2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-4-nitrophenoxy]phenyl]azetidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171083270 |
| Molecular Formula | C32H35IN6O6S |
| Molecular Weight | 758.64 g/mol |
| Exact Mass | 758.14 |
| IUPAC Name | tert-butyl 4-[1-[3-[2-(1-iodosulfanyl-6-methyl-7-oxopyrrolo[2,3-c]pyridin-4-yl)-4-nitrophenoxy]phenyl]azetidin-3-yl]piperazine-1-carboxylate |
| SMILES | Cn1cc(-c2cc([N+](=O)[O-])ccc2Oc2cccc(N3CC(N4CCN(C(=O)OC(C)(C)C)CC4)C3)c2)c2ccn(SI)c2c1=O |
| InChI | InChI=1S/C32H35IN6O6S/c1-32(2,3)45-31(41)36-14-12-35(13-15-36)23-18-37(19-23)21-6-5-7-24(16-21)44-28-9-8-22(39(42)43)17-26(28)27-20-34(4)30(40)29-25(27)10-11-38(29)46-33/h5-11,16-17,20,23H,12-15,18-19H2,1-4H3 |
| InChIKey | RKVIIRSVFIJZIW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 115.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|