C31H30F2N4O6 — CID 90416432
tert-butyl 4-[3-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 90416432) has the molecular formula C31H30F2N4O6 and a molecular weight of 592.60 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 90416432 |
| Molecular Formula | C31H30F2N4O6 |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | tert-butyl 4-[3-[2-(2,4-difluorophenoxy)-5-nitrophenyl]-7-methoxy-1-methylpyrrolo[2,3-c]pyridin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COc1nc(C2=CCN(C(=O)OC(C)(C)C)CC2)cc2c(-c3cc([N+](=O)[O-])ccc3Oc3ccc(F)cc3F)cn(C)c12 |
| InChI | InChI=1S/C31H30F2N4O6/c1-31(2,3)43-30(38)36-12-10-18(11-13-36)25-16-22-23(17-35(4)28(22)29(34-25)41-5)21-15-20(37(39)40)7-9-26(21)42-27-8-6-19(32)14-24(27)33/h6-10,14-17H,11-13H2,1-5H3 |
| InChIKey | YJPITXODRYONNB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 108.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|