C21H23N3O — CID 171085869
2-(2-methoxy-4,6-dimethylphenyl)-7-pyrrolidin-3-yl-1,8-naphthyridine (PubChem CID 171085869) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-(2-methoxy-4,6-dimethylphenyl)-7-pyrrolidin-3-yl-1,8-naphthyridine.
| Compound Name | 2-(2-methoxy-4,6-dimethylphenyl)-7-pyrrolidin-3-yl-1,8-naphthyridine |
|---|---|
| PubChem CID | 171085869 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-(2-methoxy-4,6-dimethylphenyl)-7-pyrrolidin-3-yl-1,8-naphthyridine |
| SMILES | COc1cc(C)cc(C)c1-c1ccc2ccc(C3CCNC3)nc2n1 |
| InChI | InChI=1S/C21H23N3O/c1-13-10-14(2)20(19(11-13)25-3)18-7-5-15-4-6-17(23-21(15)24-18)16-8-9-22-12-16/h4-7,10-11,16,22H,8-9,12H2,1-3H3 |
| InChIKey | JFXLGLOSYJORLO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |