C25H38BN3O2 — CID 171086589
CID 171086589 (PubChem CID 171086589) has the molecular formula C25H38BN3O2 and a molecular weight of 423.41 g/mol.
| Compound Name | CID 171086589 |
|---|---|
| PubChem CID | 171086589 |
| Molecular Formula | C25H38BN3O2 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | — |
| SMILES | CC.[B]N1CCN(Cc2c(CC)cc(-c3cn(C)c(=O)c(C)c3C)cc2OC)C(C)C1 |
| InChI | InChI=1S/C23H32BN3O2.C2H6/c1-7-18-10-19(20-13-25(5)23(28)17(4)16(20)3)11-22(29-6)21(18)14-26-8-9-27(24)12-15(26)2;1-2/h10-11,13,15H,7-9,12,14H2,1-6H3;1-2H3 |
| InChIKey | VCGJJGCLQKEPEQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|