C14H15FN4O2S — CID 171087301
4-[(5-cyclobutylpyrimidin-2-yl)amino]-3-fluorobenzenesulfonamide (PubChem CID 171087301) has the molecular formula C14H15FN4O2S and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[(5-cyclobutylpyrimidin-2-yl)amino]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(5-cyclobutylpyrimidin-2-yl)amino]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 171087301 |
| Molecular Formula | C14H15FN4O2S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(5-cyclobutylpyrimidin-2-yl)amino]-3-fluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ncc(C3CCC3)cn2)c(F)c1 |
| InChI | InChI=1S/C14H15FN4O2S/c15-12-6-11(22(16,20)21)4-5-13(12)19-14-17-7-10(8-18-14)9-2-1-3-9/h4-9H,1-3H2,(H2,16,20,21)(H,17,18,19) |
| InChIKey | LHOSDLZSJKJWAN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |