C18H21F2N5O2S — CID 171087639
[3-[2-(4-aminosulfanylanilino)pyrimidin-5-yl]cyclopentyl] N-(2,2-difluoroethyl)carbamate (PubChem CID 171087639) has the molecular formula C18H21F2N5O2S and a molecular weight of 409.46 g/mol. Its IUPAC name is [3-[2-(4-aminosulfanylanilino)pyrimidin-5-yl]cyclopentyl] N-(2,2-difluoroethyl)carbamate.
| Compound Name | [3-[2-(4-aminosulfanylanilino)pyrimidin-5-yl]cyclopentyl] N-(2,2-difluoroethyl)carbamate |
|---|---|
| PubChem CID | 171087639 |
| Molecular Formula | C18H21F2N5O2S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [3-[2-(4-aminosulfanylanilino)pyrimidin-5-yl]cyclopentyl] N-(2,2-difluoroethyl)carbamate |
| SMILES | NSc1ccc(Nc2ncc(C3CCC(OC(=O)NCC(F)F)C3)cn2)cc1 |
| InChI | InChI=1S/C18H21F2N5O2S/c19-16(20)10-24-18(26)27-14-4-1-11(7-14)12-8-22-17(23-9-12)25-13-2-5-15(28-21)6-3-13/h2-3,5-6,8-9,11,14,16H,1,4,7,10,21H2,(H,24,26)(H,22,23,25) |
| InChIKey | OTEJHBVRVRWAJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|