C19H23IN6O2 — CID 171091218
N-[(2,4-dimethoxyphenyl)methyl]-3-iodo-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 171091218) has the molecular formula C19H23IN6O2 and a molecular weight of 494.34 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-iodo-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-iodo-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171091218 |
| Molecular Formula | C19H23IN6O2 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-iodo-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3c2c(I)nn3C2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C19H23IN6O2/c1-27-14-4-3-12(15(9-14)28-2)10-22-18-16-17(20)25-26(19(16)24-11-23-18)13-5-7-21-8-6-13/h3-4,9,11,13,21H,5-8,10H2,1-2H3,(H,22,23,24) |
| InChIKey | POPFTEANVVVKFE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|