C19H21N5O2 — CID 171090745
1-but-3-ynyl-N-[(2,4-dimethoxyphenyl)methyl]-3-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 171090745) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-but-3-ynyl-N-[(2,4-dimethoxyphenyl)methyl]-3-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-but-3-ynyl-N-[(2,4-dimethoxyphenyl)methyl]-3-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 171090745 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-but-3-ynyl-N-[(2,4-dimethoxyphenyl)methyl]-3-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C#CCCn1nc(C)c2c(NCc3ccc(OC)cc3OC)ncnc21 |
| InChI | InChI=1S/C19H21N5O2/c1-5-6-9-24-19-17(13(2)23-24)18(21-12-22-19)20-11-14-7-8-15(25-3)10-16(14)26-4/h1,7-8,10,12H,6,9,11H2,2-4H3,(H,20,21,22) |
| InChIKey | ZHVJCWBUKFLFMP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|