C19H24IN5O2 — CID 146443724
6-(aminomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 146443724) has the molecular formula C19H24IN5O2 and a molecular weight of 481.34 g/mol. Its IUPAC name is 6-(aminomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(aminomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146443724 |
| Molecular Formula | C19H24IN5O2 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 6-(aminomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-iodo-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3c2c(I)c(CN)n3C(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H24IN5O2/c1-11(2)25-14(8-21)17(20)16-18(23-10-24-19(16)25)22-9-12-5-6-13(26-3)7-15(12)27-4/h5-7,10-11H,8-9,21H2,1-4H3,(H,22,23,24) |
| InChIKey | VGGVOLFZNYRVCR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|