C18H18F3NO — CID 171093106
1-[6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one (PubChem CID 171093106) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-[6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171093106 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CC(/C=C/c3ccc(C(F)(F)F)cc3)C2)C1 |
| InChI | InChI=1S/C18H18F3NO/c1-2-16(23)22-11-17(12-22)9-14(10-17)4-3-13-5-7-15(8-6-13)18(19,20)21/h2-8,14H,1,9-12H2/b4-3+ |
| InChIKey | UEIHEMFIPPJRLS-ONEGZZNKSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|