C30H34N8O2 — CID 171095252
5-ethyl-N-[4-[[2-ethylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-9-oxa-2,5,13,15,18-pentazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine (PubChem CID 171095252) has the molecular formula C30H34N8O2 and a molecular weight of 538.66 g/mol. Its IUPAC name is 5-ethyl-N-[4-[[2-ethylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-9-oxa-2,5,13,15,18-pentazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine.
| Compound Name | 5-ethyl-N-[4-[[2-ethylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-9-oxa-2,5,13,15,18-pentazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine |
|---|---|
| PubChem CID | 171095252 |
| Molecular Formula | C30H34N8O2 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 5-ethyl-N-[4-[[2-ethylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-9-oxa-2,5,13,15,18-pentazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine |
| SMILES | CC=C1C=C(Oc2ccc(Nc3ncnc4cc5c(nc34)N3CCN(CC)CC3CO5)cc2C)C=CN1/N=C\C |
| InChI | InChI=1S/C30H34N8O2/c1-5-22-15-24(10-11-38(22)33-6-2)40-26-9-8-21(14-20(26)4)34-29-28-25(31-19-32-29)16-27-30(35-28)37-13-12-36(7-3)17-23(37)18-39-27/h5-6,8-11,14-16,19,23H,7,12-13,17-18H2,1-4H3,(H,31,32,34)/b22-5?,33-6- |
| InChIKey | CEYLOUKRWNHXLN-BRCWEYBGSA-N |
| XLogP | 4.98 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|