C31H39N9O2 — CID 162428788
6-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-N-[4-[[2-butan-2-ylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-5,6-dihydropyrimido[5,4-d]pyrimidin-4-amine (PubChem CID 162428788) has the molecular formula C31H39N9O2 and a molecular weight of 569.71 g/mol. Its IUPAC name is 6-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-N-[4-[[2-butan-2-ylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-5,6-dihydropyrimido[5,4-d]pyrimidin-4-amine.
| Compound Name | 6-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-N-[4-[[2-butan-2-ylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-5,6-dihydropyrimido[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 162428788 |
| Molecular Formula | C31H39N9O2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.32 |
| IUPAC Name | 6-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-N-[4-[[2-butan-2-ylidene-1-[(Z)-ethylideneamino]-4-pyridinyl]oxy]-3-methylphenyl]-5,6-dihydropyrimido[5,4-d]pyrimidin-4-amine |
| SMILES | C/C=N\N1C=CC(Oc2ccc(Nc3ncnc4c3NC(N3CCN5CCOCC5C3)N=C4)cc2C)=CC1=C(C)CC |
| InChI | InChI=1S/C31H39N9O2/c1-5-21(3)27-16-25(9-10-40(27)35-6-2)42-28-8-7-23(15-22(28)4)36-30-29-26(33-20-34-30)17-32-31(37-29)39-12-11-38-13-14-41-19-24(38)18-39/h6-10,15-17,20,24,31,37H,5,11-14,18-19H2,1-4H3,(H,33,34,36)/b27-21?,35-6- |
| InChIKey | NJBZPMKJBOQNGF-ORZLKFJESA-N |
| XLogP | 4.45 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|